C18H19Cl2NO3 — CID 18830644
5-(cyclohexyloxymethyl)-N-(2,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 18830644) has the molecular formula C18H19Cl2NO3 and a molecular weight of 368.26 g/mol. Its IUPAC name is 5-(cyclohexyloxymethyl)-N-(2,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | 5-(cyclohexyloxymethyl)-N-(2,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 18830644 |
| Molecular Formula | C18H19Cl2NO3 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 5-(cyclohexyloxymethyl)-N-(2,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1ccc(COC2CCCCC2)o1 |
| InChI | InChI=1S/C18H19Cl2NO3/c19-12-6-8-16(15(20)10-12)21-18(22)17-9-7-14(24-17)11-23-13-4-2-1-3-5-13/h6-10,13H,1-5,11H2,(H,21,22) |
| InChIKey | VLSNOYRJCPAORM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |