C16H26NO+ — CID 8004670
[(1S,2S,3S)-2,3-dimethylcyclohexyl]-[(2-methoxyphenyl)methyl]azanium (PubChem CID 8004670) has the molecular formula C16H26NO+ and a molecular weight of 248.39 g/mol. Its IUPAC name is [(1S,2S,3S)-2,3-dimethylcyclohexyl]-[(2-methoxyphenyl)methyl]azanium.
| Compound Name | [(1S,2S,3S)-2,3-dimethylcyclohexyl]-[(2-methoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 8004670 |
| Molecular Formula | C16H26NO+ |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | [(1S,2S,3S)-2,3-dimethylcyclohexyl]-[(2-methoxyphenyl)methyl]azanium |
| SMILES | COc1ccccc1C[NH2+][C@H]1CCC[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C16H25NO/c1-12-7-6-9-15(13(12)2)17-11-14-8-4-5-10-16(14)18-3/h4-5,8,10,12-13,15,17H,6-7,9,11H2,1-3H3/p+1/t12-,13-,15-/m0/s1 |
| InChIKey | AWGXUBZXRCQJNY-YDHLFZDLSA-O |
| XLogP | 2.58 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |