C16H26NO2+ — CID 6940711
[(1R,2S)-2-methoxycyclohexyl]-[2-(2-methoxyphenyl)ethyl]azanium (PubChem CID 6940711) has the molecular formula C16H26NO2+ and a molecular weight of 264.39 g/mol. Its IUPAC name is [(1R,2S)-2-methoxycyclohexyl]-[2-(2-methoxyphenyl)ethyl]azanium.
| Compound Name | [(1R,2S)-2-methoxycyclohexyl]-[2-(2-methoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 6940711 |
| Molecular Formula | C16H26NO2+ |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | [(1R,2S)-2-methoxycyclohexyl]-[2-(2-methoxyphenyl)ethyl]azanium |
| SMILES | COc1ccccc1CC[NH2+][C@@H]1CCCC[C@@H]1OC |
| InChI | InChI=1S/C16H25NO2/c1-18-15-9-5-3-7-13(15)11-12-17-14-8-4-6-10-16(14)19-2/h3,5,7,9,14,16-17H,4,6,8,10-12H2,1-2H3/p+1/t14-,16+/m1/s1 |
| InChIKey | UCPUZQNWLLHCMH-ZBFHGGJFSA-O |
| XLogP | 1.76 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |