C15H24NO+ — CID 6944367
[(1S,2S)-2-methoxycyclohexyl]-(2-phenylethyl)azanium (PubChem CID 6944367) has the molecular formula C15H24NO+ and a molecular weight of 234.36 g/mol. Its IUPAC name is [(1S,2S)-2-methoxycyclohexyl]-(2-phenylethyl)azanium.
| Compound Name | [(1S,2S)-2-methoxycyclohexyl]-(2-phenylethyl)azanium |
|---|---|
| PubChem CID | 6944367 |
| Molecular Formula | C15H24NO+ |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.19 |
| IUPAC Name | [(1S,2S)-2-methoxycyclohexyl]-(2-phenylethyl)azanium |
| SMILES | CO[C@H]1CCCC[C@@H]1[NH2+]CCc1ccccc1 |
| InChI | InChI=1S/C15H23NO/c1-17-15-10-6-5-9-14(15)16-12-11-13-7-3-2-4-8-13/h2-4,7-8,14-16H,5-6,9-12H2,1H3/p+1/t14-,15-/m0/s1 |
| InChIKey | NAMQJTJLKSDSAA-GJZGRUSLSA-O |
| XLogP | 1.75 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |