C15H22Cl2NO+ — CID 4743356
2-(2,4-dichlorophenyl)ethyl-(2-methoxycyclohexyl)azanium (PubChem CID 4743356) has the molecular formula C15H22Cl2NO+ and a molecular weight of 303.25 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)ethyl-(2-methoxycyclohexyl)azanium.
| Compound Name | 2-(2,4-dichlorophenyl)ethyl-(2-methoxycyclohexyl)azanium |
|---|---|
| PubChem CID | 4743356 |
| Molecular Formula | C15H22Cl2NO+ |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-(2,4-dichlorophenyl)ethyl-(2-methoxycyclohexyl)azanium |
| SMILES | COC1CCCCC1[NH2+]CCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H21Cl2NO/c1-19-15-5-3-2-4-14(15)18-9-8-11-6-7-12(16)10-13(11)17/h6-7,10,14-15,18H,2-5,8-9H2,1H3/p+1 |
| InChIKey | IUSFWLVPOJVAGO-UHFFFAOYSA-O |
| XLogP | 3.06 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |