C15H23FNO+ — CID 6962801
2-(3-fluorophenyl)ethyl-[(1S,2S)-2-methoxycyclohexyl]azanium (PubChem CID 6962801) has the molecular formula C15H23FNO+ and a molecular weight of 252.35 g/mol. Its IUPAC name is 2-(3-fluorophenyl)ethyl-[(1S,2S)-2-methoxycyclohexyl]azanium.
| Compound Name | 2-(3-fluorophenyl)ethyl-[(1S,2S)-2-methoxycyclohexyl]azanium |
|---|---|
| PubChem CID | 6962801 |
| Molecular Formula | C15H23FNO+ |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2-(3-fluorophenyl)ethyl-[(1S,2S)-2-methoxycyclohexyl]azanium |
| SMILES | CO[C@H]1CCCC[C@@H]1[NH2+]CCc1cccc(F)c1 |
| InChI | InChI=1S/C15H22FNO/c1-18-15-8-3-2-7-14(15)17-10-9-12-5-4-6-13(16)11-12/h4-6,11,14-15,17H,2-3,7-10H2,1H3/p+1/t14-,15-/m0/s1 |
| InChIKey | ATOIFDNGIQBLAA-GJZGRUSLSA-O |
| XLogP | 1.89 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |