C14H20FN — CID 114834091
2-cyclopentyl-1-(3-fluorophenyl)propan-2-amine (PubChem CID 114834091) has the molecular formula C14H20FN and a molecular weight of 221.32 g/mol. Its IUPAC name is 2-cyclopentyl-1-(3-fluorophenyl)propan-2-amine.
| Compound Name | 2-cyclopentyl-1-(3-fluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 114834091 |
| Molecular Formula | C14H20FN |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 2-cyclopentyl-1-(3-fluorophenyl)propan-2-amine |
| SMILES | CC(N)(Cc1cccc(F)c1)C1CCCC1 |
| InChI | InChI=1S/C14H20FN/c1-14(16,12-6-2-3-7-12)10-11-5-4-8-13(15)9-11/h4-5,8-9,12H,2-3,6-7,10,16H2,1H3 |
| InChIKey | YASRZHCTYLJKQB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |