C15H19Cl2F — CID 112571036
1-[3-chloro-2-(chloromethyl)-2-cyclopentylpropyl]-3-fluorobenzene (PubChem CID 112571036) has the molecular formula C15H19Cl2F and a molecular weight of 289.22 g/mol. Its IUPAC name is 1-[3-chloro-2-(chloromethyl)-2-cyclopentylpropyl]-3-fluorobenzene.
| Compound Name | 1-[3-chloro-2-(chloromethyl)-2-cyclopentylpropyl]-3-fluorobenzene |
|---|---|
| PubChem CID | 112571036 |
| Molecular Formula | C15H19Cl2F |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1-[3-chloro-2-(chloromethyl)-2-cyclopentylpropyl]-3-fluorobenzene |
| SMILES | Fc1cccc(CC(CCl)(CCl)C2CCCC2)c1 |
| InChI | InChI=1S/C15H19Cl2F/c16-10-15(11-17,13-5-1-2-6-13)9-12-4-3-7-14(18)8-12/h3-4,7-8,13H,1-2,5-6,9-11H2 |
| InChIKey | XVMTVZIKXUHTOM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|