C22H36N2O3 — CID 162432629
1-(cycloheptylmethyl)-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine (PubChem CID 162432629) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is 1-(cycloheptylmethyl)-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-(cycloheptylmethyl)-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 162432629 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | 1-(cycloheptylmethyl)-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(CN2CCN(CC3CCCCCC3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C22H36N2O3/c1-25-20-11-10-19(21(26-2)22(20)27-3)17-24-14-12-23(13-15-24)16-18-8-6-4-5-7-9-18/h10-11,18H,4-9,12-17H2,1-3H3 |
| InChIKey | HZJLJIZRXOMRPP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |