C18H25N3O5S — CID 3956165
methyl 4-[[[2-[cyclohexyl(methylsulfonyl)amino]acetyl]hydrazinylidene]methyl]benzoate (PubChem CID 3956165) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is methyl 4-[[[2-[cyclohexyl(methylsulfonyl)amino]acetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[[[2-[cyclohexyl(methylsulfonyl)amino]acetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 3956165 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | methyl 4-[[[2-[cyclohexyl(methylsulfonyl)amino]acetyl]hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=NNC(=O)CN(C2CCCCC2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H25N3O5S/c1-26-18(23)15-10-8-14(9-11-15)12-19-20-17(22)13-21(27(2,24)25)16-6-4-3-5-7-16/h8-12,16H,3-7,13H2,1-2H3,(H,20,22) |
| InChIKey | CWLZWEBJHRDZGO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|