C28H39N3O3S — CID 4575278
N-[(4-tert-butylphenyl)methylideneamino]-2-[cyclohexyl-(2,4,6-trimethylphenyl)sulfonylamino]acetamide (PubChem CID 4575278) has the molecular formula C28H39N3O3S and a molecular weight of 497.71 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methylideneamino]-2-[cyclohexyl-(2,4,6-trimethylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[(4-tert-butylphenyl)methylideneamino]-2-[cyclohexyl-(2,4,6-trimethylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 4575278 |
| Molecular Formula | C28H39N3O3S |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | N-[(4-tert-butylphenyl)methylideneamino]-2-[cyclohexyl-(2,4,6-trimethylphenyl)sulfonylamino]acetamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(CC(=O)NN=Cc2ccc(C(C)(C)C)cc2)C2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C28H39N3O3S/c1-20-16-21(2)27(22(3)17-20)35(33,34)31(25-10-8-7-9-11-25)19-26(32)30-29-18-23-12-14-24(15-13-23)28(4,5)6/h12-18,25H,7-11,19H2,1-6H3,(H,30,32) |
| InChIKey | RFDMYNHFPCHAEK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|