C23H30N4O3S — CID 4264576
2-[cyclohexyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethylideneamino)acetamide (PubChem CID 4264576) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is 2-[cyclohexyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethylideneamino)acetamide.
| Compound Name | 2-[cyclohexyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 4264576 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-[cyclohexyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethylideneamino)acetamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(CC(=O)NN=Cc2ccccn2)C2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C23H30N4O3S/c1-17-13-18(2)23(19(3)14-17)31(29,30)27(21-10-5-4-6-11-21)16-22(28)26-25-15-20-9-7-8-12-24-20/h7-9,12-15,21H,4-6,10-11,16H2,1-3H3,(H,26,28) |
| InChIKey | QEUYVGHUNYXCIL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|