C28H33N3O3S — CID 5182080
2-[cyclohexyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-(naphthalen-1-ylmethylideneamino)acetamide (PubChem CID 5182080) has the molecular formula C28H33N3O3S and a molecular weight of 491.66 g/mol. Its IUPAC name is 2-[cyclohexyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-(naphthalen-1-ylmethylideneamino)acetamide.
| Compound Name | 2-[cyclohexyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-(naphthalen-1-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 5182080 |
| Molecular Formula | C28H33N3O3S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 2-[cyclohexyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-(naphthalen-1-ylmethylideneamino)acetamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(CC(=O)NN=Cc2cccc3ccccc23)C2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C28H33N3O3S/c1-20-16-21(2)28(22(3)17-20)35(33,34)31(25-13-5-4-6-14-25)19-27(32)30-29-18-24-12-9-11-23-10-7-8-15-26(23)24/h7-12,15-18,25H,4-6,13-14,19H2,1-3H3,(H,30,32) |
| InChIKey | YTLZEJDXOJAJGC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|