C22H26BrN3O5S — CID 3717230
2-[(4-bromophenyl)sulfonyl-cyclohexylamino]-N-[(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 3717230) has the molecular formula C22H26BrN3O5S and a molecular weight of 524.44 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonyl-cyclohexylamino]-N-[(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(4-bromophenyl)sulfonyl-cyclohexylamino]-N-[(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3717230 |
| Molecular Formula | C22H26BrN3O5S |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 523.08 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonyl-cyclohexylamino]-N-[(2-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cccc(C=NNC(=O)CN(C2CCCCC2)S(=O)(=O)c2ccc(Br)cc2)c1O |
| InChI | InChI=1S/C22H26BrN3O5S/c1-31-20-9-5-6-16(22(20)28)14-24-25-21(27)15-26(18-7-3-2-4-8-18)32(29,30)19-12-10-17(23)11-13-19/h5-6,9-14,18,28H,2-4,7-8,15H2,1H3,(H,25,27) |
| InChIKey | YYHXOXCATJDMFL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|