C23H29N3O5S — CID 92511645
2-[benzenesulfonyl(cyclohexyl)amino]-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]acetamide (PubChem CID 92511645) has the molecular formula C23H29N3O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is 2-[benzenesulfonyl(cyclohexyl)amino]-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzenesulfonyl(cyclohexyl)amino]-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 92511645 |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 2-[benzenesulfonyl(cyclohexyl)amino]-N-[(E)-(2,4-dimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(/C=N/NC(=O)CN(C2CCCCC2)S(=O)(=O)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C23H29N3O5S/c1-30-20-14-13-18(22(15-20)31-2)16-24-25-23(27)17-26(19-9-5-3-6-10-19)32(28,29)21-11-7-4-8-12-21/h4,7-8,11-16,19H,3,5-6,9-10,17H2,1-2H3,(H,25,27)/b24-16+ |
| InChIKey | UUFHVRXDGFSBES-LFVJCYFKSA-N |
| XLogP | 3.18 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|