C24H30N2O7S — CID 45372813
methyl 2-[[2-[benzenesulfonyl(cyclohexyl)amino]acetyl]amino]-4,5-dimethoxybenzoate (PubChem CID 45372813) has the molecular formula C24H30N2O7S and a molecular weight of 490.58 g/mol. Its IUPAC name is methyl 2-[[2-[benzenesulfonyl(cyclohexyl)amino]acetyl]amino]-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-[[2-[benzenesulfonyl(cyclohexyl)amino]acetyl]amino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 45372813 |
| Molecular Formula | C24H30N2O7S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | methyl 2-[[2-[benzenesulfonyl(cyclohexyl)amino]acetyl]amino]-4,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)cc1NC(=O)CN(C1CCCCC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H30N2O7S/c1-31-21-14-19(24(28)33-3)20(15-22(21)32-2)25-23(27)16-26(17-10-6-4-7-11-17)34(29,30)18-12-8-5-9-13-18/h5,8-9,12-15,17H,4,6-7,10-11,16H2,1-3H3,(H,25,27) |
| InChIKey | GLUVKNCZTYWDLM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |