C12H17NO6S — CID 86720360
methyl 3-[2-hydroxyethyl(methylsulfonyl)amino]-4-methoxybenzoate (PubChem CID 86720360) has the molecular formula C12H17NO6S and a molecular weight of 303.34 g/mol. Its IUPAC name is methyl 3-[2-hydroxyethyl(methylsulfonyl)amino]-4-methoxybenzoate.
| Compound Name | methyl 3-[2-hydroxyethyl(methylsulfonyl)amino]-4-methoxybenzoate |
|---|---|
| PubChem CID | 86720360 |
| Molecular Formula | C12H17NO6S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | methyl 3-[2-hydroxyethyl(methylsulfonyl)amino]-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)c(N(CCO)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H17NO6S/c1-18-11-5-4-9(12(15)19-2)8-10(11)13(6-7-14)20(3,16)17/h4-5,8,14H,6-7H2,1-3H3 |
| InChIKey | IAGWTVJDNLQGSR-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |