C15H21ClN2O5S — CID 113145668
methyl 4-chloro-3-[methylsulfonyl-[3-oxo-3-(propan-2-ylamino)propyl]amino]benzoate (PubChem CID 113145668) has the molecular formula C15H21ClN2O5S and a molecular weight of 376.86 g/mol. Its IUPAC name is methyl 4-chloro-3-[methylsulfonyl-[3-oxo-3-(propan-2-ylamino)propyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[methylsulfonyl-[3-oxo-3-(propan-2-ylamino)propyl]amino]benzoate |
|---|---|
| PubChem CID | 113145668 |
| Molecular Formula | C15H21ClN2O5S |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | methyl 4-chloro-3-[methylsulfonyl-[3-oxo-3-(propan-2-ylamino)propyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(N(CCC(=O)NC(C)C)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H21ClN2O5S/c1-10(2)17-14(19)7-8-18(24(4,21)22)13-9-11(15(20)23-3)5-6-12(13)16/h5-6,9-10H,7-8H2,1-4H3,(H,17,19) |
| InChIKey | VVINDIILAHNWJG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |