C11H14N2O6S — CID 86679498
3-[(2-amino-2-oxoethyl)-methylsulfonylamino]-4-methoxybenzoic acid (PubChem CID 86679498) has the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. Its IUPAC name is 3-[(2-amino-2-oxoethyl)-methylsulfonylamino]-4-methoxybenzoic acid.
| Compound Name | 3-[(2-amino-2-oxoethyl)-methylsulfonylamino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 86679498 |
| Molecular Formula | C11H14N2O6S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 3-[(2-amino-2-oxoethyl)-methylsulfonylamino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1N(CC(N)=O)S(C)(=O)=O |
| InChI | InChI=1S/C11H14N2O6S/c1-19-9-4-3-7(11(15)16)5-8(9)13(6-10(12)14)20(2,17)18/h3-5H,6H2,1-2H3,(H2,12,14)(H,15,16) |
| InChIKey | QPKLMTIYNBLNMC-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |