C15H15BFN3O3S — CID 145238312
CID 145238312 (PubChem CID 145238312) has the molecular formula C15H15BFN3O3S and a molecular weight of 347.18 g/mol.
| Compound Name | CID 145238312 |
|---|---|
| PubChem CID | 145238312 |
| Molecular Formula | C15H15BFN3O3S |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(N(Cc2ccc(C(=O)NN)cc2F)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H15BFN3O3S/c1-24(22,23)20(13-6-4-12(16)5-7-13)9-11-3-2-10(8-14(11)17)15(21)19-18/h2-8H,9,18H2,1H3,(H,19,21) |
| InChIKey | XLBAAQYCERIGSQ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|