C16H15F2N3O2 — CID 126544337
N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-(3-fluorophenyl)acetamide (PubChem CID 126544337) has the molecular formula C16H15F2N3O2 and a molecular weight of 319.31 g/mol. Its IUPAC name is N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-(3-fluorophenyl)acetamide.
| Compound Name | N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126544337 |
| Molecular Formula | C16H15F2N3O2 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-(3-fluorophenyl)acetamide |
| SMILES | CC(=O)N(Cc1ccc(C(=O)NN)cc1F)c1cccc(F)c1 |
| InChI | InChI=1S/C16H15F2N3O2/c1-10(22)21(14-4-2-3-13(17)8-14)9-12-6-5-11(7-15(12)18)16(23)20-19/h2-8H,9,19H2,1H3,(H,20,23) |
| InChIKey | CGCHZCWFTDZTDC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|