C24H26F2N4 — CID 145239468
ethane;3-fluoro-N-[[2-fluoro-4-(1-hydrazinylethenyl)phenyl]methyl]-N-(1-pyridin-4-ylethenyl)aniline (PubChem CID 145239468) has the molecular formula C24H26F2N4 and a molecular weight of 408.50 g/mol. Its IUPAC name is ethane;3-fluoro-N-[[2-fluoro-4-(1-hydrazinylethenyl)phenyl]methyl]-N-(1-pyridin-4-ylethenyl)aniline.
| Compound Name | ethane;3-fluoro-N-[[2-fluoro-4-(1-hydrazinylethenyl)phenyl]methyl]-N-(1-pyridin-4-ylethenyl)aniline |
|---|---|
| PubChem CID | 145239468 |
| Molecular Formula | C24H26F2N4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | ethane;3-fluoro-N-[[2-fluoro-4-(1-hydrazinylethenyl)phenyl]methyl]-N-(1-pyridin-4-ylethenyl)aniline |
| SMILES | C=C(NN)c1ccc(CN(C(=C)c2ccncc2)c2cccc(F)c2)c(F)c1.CC |
| InChI | InChI=1S/C22H20F2N4.C2H6/c1-15(27-25)18-6-7-19(22(24)12-18)14-28(21-5-3-4-20(23)13-21)16(2)17-8-10-26-11-9-17;1-2/h3-13,27H,1-2,14,25H2;1-2H3 |
| InChIKey | DBVOHZXHEGGWCU-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|