C19H20F2N4O3 — CID 140894938
N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-(3-fluorophenyl)morpholine-4-carboxamide (PubChem CID 140894938) has the molecular formula C19H20F2N4O3 and a molecular weight of 390.39 g/mol. Its IUPAC name is N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-(3-fluorophenyl)morpholine-4-carboxamide.
| Compound Name | N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-(3-fluorophenyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 140894938 |
| Molecular Formula | C19H20F2N4O3 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-(3-fluorophenyl)morpholine-4-carboxamide |
| SMILES | NNC(=O)c1ccc(CN(C(=O)N2CCOCC2)c2cccc(F)c2)c(F)c1 |
| InChI | InChI=1S/C19H20F2N4O3/c20-15-2-1-3-16(11-15)25(19(27)24-6-8-28-9-7-24)12-14-5-4-13(10-17(14)21)18(26)23-22/h1-5,10-11H,6-9,12,22H2,(H,23,26) |
| InChIKey | IPTBLHSVCCIBMD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|