C19H20ClFN4O4S — CID 140895144
N-(3-chlorophenyl)-N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide (PubChem CID 140895144) has the molecular formula C19H20ClFN4O4S and a molecular weight of 454.91 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide.
| Compound Name | N-(3-chlorophenyl)-N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide |
|---|---|
| PubChem CID | 140895144 |
| Molecular Formula | C19H20ClFN4O4S |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-(3-chlorophenyl)-N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-1,1-dioxo-1,4-thiazinane-4-carboxamide |
| SMILES | NNC(=O)c1ccc(CN(C(=O)N2CCS(=O)(=O)CC2)c2cccc(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C19H20ClFN4O4S/c20-15-2-1-3-16(11-15)25(19(27)24-6-8-30(28,29)9-7-24)12-14-5-4-13(10-17(14)21)18(26)23-22/h1-5,10-11H,6-9,12,22H2,(H,23,26) |
| InChIKey | MFBYGCQVKNHAFC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|