C19H19ClFN3O3 — CID 134584573
4-[[3-chloro-N-(piperazine-1-carbonyl)anilino]methyl]-3-fluorobenzoic acid (PubChem CID 134584573) has the molecular formula C19H19ClFN3O3 and a molecular weight of 391.83 g/mol. Its IUPAC name is 4-[[3-chloro-N-(piperazine-1-carbonyl)anilino]methyl]-3-fluorobenzoic acid.
| Compound Name | 4-[[3-chloro-N-(piperazine-1-carbonyl)anilino]methyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 134584573 |
| Molecular Formula | C19H19ClFN3O3 |
| Molecular Weight | 391.83 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 4-[[3-chloro-N-(piperazine-1-carbonyl)anilino]methyl]-3-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(CN(C(=O)N2CCNCC2)c2cccc(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C19H19ClFN3O3/c20-15-2-1-3-16(11-15)24(19(27)23-8-6-22-7-9-23)12-14-5-4-13(18(25)26)10-17(14)21/h1-5,10-11,22H,6-9,12H2,(H,25,26) |
| InChIKey | UTWBRDJOAATXCS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.83 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |