C20H21ClFN3O3 — CID 134584560
methyl 4-[[3-chloro-N-(piperazine-1-carbonyl)anilino]methyl]-3-fluorobenzoate (PubChem CID 134584560) has the molecular formula C20H21ClFN3O3 and a molecular weight of 405.86 g/mol. Its IUPAC name is methyl 4-[[3-chloro-N-(piperazine-1-carbonyl)anilino]methyl]-3-fluorobenzoate.
| Compound Name | methyl 4-[[3-chloro-N-(piperazine-1-carbonyl)anilino]methyl]-3-fluorobenzoate |
|---|---|
| PubChem CID | 134584560 |
| Molecular Formula | C20H21ClFN3O3 |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | methyl 4-[[3-chloro-N-(piperazine-1-carbonyl)anilino]methyl]-3-fluorobenzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)N2CCNCC2)c2cccc(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C20H21ClFN3O3/c1-28-19(26)14-5-6-15(18(22)11-14)13-25(17-4-2-3-16(21)12-17)20(27)24-9-7-23-8-10-24/h2-6,11-12,23H,7-10,13H2,1H3 |
| InChIKey | PQBSQNXUMGTXGU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |