C19H20ClN3O3 — CID 134584439
4-[[3-chloro-N-(piperazine-1-carbonyl)anilino]methyl]benzoic acid (PubChem CID 134584439) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is 4-[[3-chloro-N-(piperazine-1-carbonyl)anilino]methyl]benzoic acid.
| Compound Name | 4-[[3-chloro-N-(piperazine-1-carbonyl)anilino]methyl]benzoic acid |
|---|---|
| PubChem CID | 134584439 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 4-[[3-chloro-N-(piperazine-1-carbonyl)anilino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN(C(=O)N2CCNCC2)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H20ClN3O3/c20-16-2-1-3-17(12-16)23(19(26)22-10-8-21-9-11-22)13-14-4-6-15(7-5-14)18(24)25/h1-7,12,21H,8-11,13H2,(H,24,25) |
| InChIKey | FXAYDBXSCGCURI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |