C24H26FN5O3 — CID 140894209
N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-[3-(furan-3-yl)phenyl]-4-methylpiperazine-1-carboxamide (PubChem CID 140894209) has the molecular formula C24H26FN5O3 and a molecular weight of 451.50 g/mol. Its IUPAC name is N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-[3-(furan-3-yl)phenyl]-4-methylpiperazine-1-carboxamide.
| Compound Name | N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-[3-(furan-3-yl)phenyl]-4-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 140894209 |
| Molecular Formula | C24H26FN5O3 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-[3-(furan-3-yl)phenyl]-4-methylpiperazine-1-carboxamide |
| SMILES | CN1CCN(C(=O)N(Cc2ccc(C(=O)NN)cc2F)c2cccc(-c3ccoc3)c2)CC1 |
| InChI | InChI=1S/C24H26FN5O3/c1-28-8-10-29(11-9-28)24(32)30(15-19-6-5-18(14-22(19)25)23(31)27-26)21-4-2-3-17(13-21)20-7-12-33-16-20/h2-7,12-14,16H,8-11,15,26H2,1H3,(H,27,31) |
| InChIKey | QPMCVVHPJQSWRL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|