C20H23FN4O3S — CID 172820030
N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-(4-methoxyphenyl)thiomorpholine-4-carboxamide (PubChem CID 172820030) has the molecular formula C20H23FN4O3S and a molecular weight of 418.49 g/mol. Its IUPAC name is N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-(4-methoxyphenyl)thiomorpholine-4-carboxamide.
| Compound Name | N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-(4-methoxyphenyl)thiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 172820030 |
| Molecular Formula | C20H23FN4O3S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-(4-methoxyphenyl)thiomorpholine-4-carboxamide |
| SMILES | COc1ccc(N(Cc2ccc(C(=O)NN)cc2F)C(=O)N2CCSCC2)cc1 |
| InChI | InChI=1S/C20H23FN4O3S/c1-28-17-6-4-16(5-7-17)25(20(27)24-8-10-29-11-9-24)13-15-3-2-14(12-18(15)21)19(26)23-22/h2-7,12H,8-11,13,22H2,1H3,(H,23,26) |
| InChIKey | UCHRPZJUFKARKI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|