C21H23FN2O4S — CID 175166159
methyl 3-fluoro-4-[[4-methoxy-N-(thiomorpholine-4-carbonyl)anilino]methyl]benzoate (PubChem CID 175166159) has the molecular formula C21H23FN2O4S and a molecular weight of 418.49 g/mol. Its IUPAC name is methyl 3-fluoro-4-[[4-methoxy-N-(thiomorpholine-4-carbonyl)anilino]methyl]benzoate.
| Compound Name | methyl 3-fluoro-4-[[4-methoxy-N-(thiomorpholine-4-carbonyl)anilino]methyl]benzoate |
|---|---|
| PubChem CID | 175166159 |
| Molecular Formula | C21H23FN2O4S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | methyl 3-fluoro-4-[[4-methoxy-N-(thiomorpholine-4-carbonyl)anilino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)N2CCSCC2)c2ccc(OC)cc2)c(F)c1 |
| InChI | InChI=1S/C21H23FN2O4S/c1-27-18-7-5-17(6-8-18)24(21(26)23-9-11-29-12-10-23)14-16-4-3-15(13-19(16)22)20(25)28-2/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | PXKVLCOSWARLBS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |