C23H28FN3O4 — CID 140894210
methyl 4-[(N-(4-ethylpiperazine-1-carbonyl)-4-methoxyanilino)methyl]-3-fluorobenzoate (PubChem CID 140894210) has the molecular formula C23H28FN3O4 and a molecular weight of 429.49 g/mol. Its IUPAC name is methyl 4-[(N-(4-ethylpiperazine-1-carbonyl)-4-methoxyanilino)methyl]-3-fluorobenzoate.
| Compound Name | methyl 4-[(N-(4-ethylpiperazine-1-carbonyl)-4-methoxyanilino)methyl]-3-fluorobenzoate |
|---|---|
| PubChem CID | 140894210 |
| Molecular Formula | C23H28FN3O4 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | methyl 4-[(N-(4-ethylpiperazine-1-carbonyl)-4-methoxyanilino)methyl]-3-fluorobenzoate |
| SMILES | CCN1CCN(C(=O)N(Cc2ccc(C(=O)OC)cc2F)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C23H28FN3O4/c1-4-25-11-13-26(14-12-25)23(29)27(19-7-9-20(30-2)10-8-19)16-18-6-5-17(15-21(18)24)22(28)31-3/h5-10,15H,4,11-14,16H2,1-3H3 |
| InChIKey | KLQXTOHQBZGHBC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |