C27H28FN3O3 — CID 140894666
methyl 3-fluoro-4-[(N-(4-methylpiperazine-1-carbonyl)-4-phenylanilino)methyl]benzoate (PubChem CID 140894666) has the molecular formula C27H28FN3O3 and a molecular weight of 461.54 g/mol. Its IUPAC name is methyl 3-fluoro-4-[(N-(4-methylpiperazine-1-carbonyl)-4-phenylanilino)methyl]benzoate.
| Compound Name | methyl 3-fluoro-4-[(N-(4-methylpiperazine-1-carbonyl)-4-phenylanilino)methyl]benzoate |
|---|---|
| PubChem CID | 140894666 |
| Molecular Formula | C27H28FN3O3 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | methyl 3-fluoro-4-[(N-(4-methylpiperazine-1-carbonyl)-4-phenylanilino)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)N2CCN(C)CC2)c2ccc(-c3ccccc3)cc2)c(F)c1 |
| InChI | InChI=1S/C27H28FN3O3/c1-29-14-16-30(17-15-29)27(33)31(19-23-9-8-22(18-25(23)28)26(32)34-2)24-12-10-21(11-13-24)20-6-4-3-5-7-20/h3-13,18H,14-17,19H2,1-2H3 |
| InChIKey | OJJBSBXLHZRBSO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |