C22H22BF4N5O3 — CID 153240807
CID 153240807 (PubChem CID 153240807) has the molecular formula C22H22BF4N5O3 and a molecular weight of 491.25 g/mol.
| Compound Name | CID 153240807 |
|---|---|
| PubChem CID | 153240807 |
| Molecular Formula | C22H22BF4N5O3 |
| Molecular Weight | 491.25 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(N(Cc2ccc(C(=O)NNC(=O)C(F)(F)F)cc2F)C(=O)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C22H22BF4N5O3/c1-30-8-10-31(11-9-30)21(35)32(17-6-4-16(23)5-7-17)13-15-3-2-14(12-18(15)24)19(33)28-29-20(34)22(25,26)27/h2-7,12H,8-11,13H2,1H3,(H,28,33)(H,29,34) |
| InChIKey | QGFKMLVWEXEXML-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|