C18H19F2N3 — CID 145239497
3-fluoro-N-[[2-fluoro-4-(1-hydrazinylethenyl)phenyl]methyl]-N-prop-1-en-2-ylaniline (PubChem CID 145239497) has the molecular formula C18H19F2N3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-fluoro-N-[[2-fluoro-4-(1-hydrazinylethenyl)phenyl]methyl]-N-prop-1-en-2-ylaniline.
| Compound Name | 3-fluoro-N-[[2-fluoro-4-(1-hydrazinylethenyl)phenyl]methyl]-N-prop-1-en-2-ylaniline |
|---|---|
| PubChem CID | 145239497 |
| Molecular Formula | C18H19F2N3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3-fluoro-N-[[2-fluoro-4-(1-hydrazinylethenyl)phenyl]methyl]-N-prop-1-en-2-ylaniline |
| SMILES | C=C(NN)c1ccc(CN(C(=C)C)c2cccc(F)c2)c(F)c1 |
| InChI | InChI=1S/C18H19F2N3/c1-12(2)23(17-6-4-5-16(19)10-17)11-15-8-7-14(9-18(15)20)13(3)22-21/h4-10,22H,1,3,11,21H2,2H3 |
| InChIKey | GYJYAPSRLGEUDE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|