C20H20F4N4O3Os — CID 147862941
1,1-di(ethyl)-3-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-3-[3-(trifluoromethoxy)phenyl]urea;osmium(2+) (PubChem CID 147862941) has the molecular formula C20H20F4N4O3Os and a molecular weight of 630.63 g/mol. Its IUPAC name is 1,1-di(ethyl)-3-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-3-[3-(trifluoromethoxy)phenyl]urea;osmium(2+).
| Compound Name | 1,1-di(ethyl)-3-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-3-[3-(trifluoromethoxy)phenyl]urea;osmium(2+) |
|---|---|
| PubChem CID | 147862941 |
| Molecular Formula | C20H20F4N4O3Os |
| Molecular Weight | 630.63 g/mol |
| Exact Mass | 632.11 |
| IUPAC Name | 1,1-di(ethyl)-3-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-3-[3-(trifluoromethoxy)phenyl]urea;osmium(2+) |
| SMILES | [CH2-]CN(C[CH2-])C(=O)N(Cc1ccc(C(=O)NN)cc1F)c1cccc(OC(F)(F)F)c1.[Os+2] |
| InChI | InChI=1S/C20H20F4N4O3.Os/c1-3-27(4-2)19(30)28(15-6-5-7-16(11-15)31-20(22,23)24)12-14-9-8-13(10-17(14)21)18(29)26-25;/h5-11H,1-4,12,25H2,(H,26,29);/q-2;+2 |
| InChIKey | WJKROHWKFCSETF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.63 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|