C24H31FN4O2 — CID 162219998
1-tert-butyl-N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-phenylpiperidine-4-carboxamide (PubChem CID 162219998) has the molecular formula C24H31FN4O2 and a molecular weight of 426.54 g/mol. Its IUPAC name is 1-tert-butyl-N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-tert-butyl-N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 162219998 |
| Molecular Formula | C24H31FN4O2 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 1-tert-butyl-N-[[2-fluoro-4-(hydrazinecarbonyl)phenyl]methyl]-N-phenylpiperidine-4-carboxamide |
| SMILES | CC(C)(C)N1CCC(C(=O)N(Cc2ccc(C(=O)NN)cc2F)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H31FN4O2/c1-24(2,3)28-13-11-17(12-14-28)23(31)29(20-7-5-4-6-8-20)16-19-10-9-18(15-21(19)25)22(30)27-26/h4-10,15,17H,11-14,16,26H2,1-3H3,(H,27,30) |
| InChIKey | ZTZKLRCRTJQWQW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|