C20H16FN3O3 — CID 126544485
methyl 6-[[3-fluoro-N-(pyridine-4-carbonyl)anilino]methyl]pyridine-3-carboxylate (PubChem CID 126544485) has the molecular formula C20H16FN3O3 and a molecular weight of 365.36 g/mol. Its IUPAC name is methyl 6-[[3-fluoro-N-(pyridine-4-carbonyl)anilino]methyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[[3-fluoro-N-(pyridine-4-carbonyl)anilino]methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 126544485 |
| Molecular Formula | C20H16FN3O3 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | methyl 6-[[3-fluoro-N-(pyridine-4-carbonyl)anilino]methyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(CN(C(=O)c2ccncc2)c2cccc(F)c2)nc1 |
| InChI | InChI=1S/C20H16FN3O3/c1-27-20(26)15-5-6-17(23-12-15)13-24(18-4-2-3-16(21)11-18)19(25)14-7-9-22-10-8-14/h2-12H,13H2,1H3 |
| InChIKey | QQLSNYBIOFOJRX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |