About methyl 6-[(3-fluoroanilino)methyl]pyridine-3-carboxylate;molecular hydrogen
methyl 6-[(3-fluoroanilino)methyl]pyridine-3-carboxylate;molecular hydrogen (PubChem CID 145238567) has the molecular formula C14H15FN2O2
and a molecular weight of 262.28 g/mol. Its IUPAC name is methyl 6-[(3-fluoroanilino)methyl]pyridine-3-carboxylate;molecular hydrogen.
Molecular Properties
| Compound Name | methyl 6-[(3-fluoroanilino)methyl]pyridine-3-carboxylate;molecular hydrogen |
| PubChem CID | 145238567 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | methyl 6-[(3-fluoroanilino)methyl]pyridine-3-carboxylate;molecular hydrogen |
| SMILES | COC(=O)c1ccc(CNc2cccc(F)c2)nc1.[H][H] |
| InChI | InChI=1S/C14H13FN2O2.H2/c1-19-14(18)10-5-6-13(16-8-10)9-17-12-4-2-3-11(15)7-12;/h2-8,17H,9H2,1H3;1H |
| InChIKey | DICYHTVFXAPKEQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 6-[(3-fluoroanilino)methyl]pyridine-3-carboxylate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[(3-fluoroanilino)methyl]pyridine-3-carboxylate;molecular hydrogen?
The IUPAC name of methyl 6-[(3-fluoroanilino)methyl]pyridine-3-carboxylate;molecular hydrogen (CID 145238567) is methyl 6-[(3-fluoroanilino)methyl]pyridine-3-carboxylate;molecular hydrogen.
What is the SMILES notation for methyl 6-[(3-fluoroanilino)methyl]pyridine-3-carboxylate;molecular hydrogen?
The canonical SMILES for methyl 6-[(3-fluoroanilino)methyl]pyridine-3-carboxylate;molecular hydrogen is COC(=O)c1ccc(CNc2cccc(F)c2)nc1.[H][H].
What is the InChIKey of methyl 6-[(3-fluoroanilino)methyl]pyridine-3-carboxylate;molecular hydrogen?
The InChIKey is DICYHTVFXAPKEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN2O2.H2/c1-19-14(18)10-5-6-13(16-8-10)9-17-12-4-2-3-11(15)7-12;/h2-8,17H,9H2,1H3;1H.
What are the key properties of methyl 6-[(3-fluoroanilino)methyl]pyridine-3-carboxylate;molecular hydrogen?
methyl 6-[(3-fluoroanilino)methyl]pyridine-3-carboxylate;molecular hydrogen has a molecular weight of 262.28 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[(3-fluoroanilino)methyl]pyridine-3-carboxylate;molecular hydrogen is sourced from PubChem (CID 145238567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).