C22H19F2N5O2 — CID 145239550
2,2-difluoroethyl (3Z)-N-methylidene-6-[[N-(pyridine-4-carbonyl)anilino]methyl]pyridine-3-carbohydrazonate (PubChem CID 145239550) has the molecular formula C22H19F2N5O2 and a molecular weight of 423.42 g/mol. Its IUPAC name is 2,2-difluoroethyl (3Z)-N-methylidene-6-[[N-(pyridine-4-carbonyl)anilino]methyl]pyridine-3-carbohydrazonate.
| Compound Name | 2,2-difluoroethyl (3Z)-N-methylidene-6-[[N-(pyridine-4-carbonyl)anilino]methyl]pyridine-3-carbohydrazonate |
|---|---|
| PubChem CID | 145239550 |
| Molecular Formula | C22H19F2N5O2 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2,2-difluoroethyl (3Z)-N-methylidene-6-[[N-(pyridine-4-carbonyl)anilino]methyl]pyridine-3-carbohydrazonate |
| SMILES | C=N/N=C(\OCC(F)F)c1ccc(CN(C(=O)c2ccncc2)c2ccccc2)nc1 |
| InChI | InChI=1S/C22H19F2N5O2/c1-25-28-21(31-15-20(23)24)17-7-8-18(27-13-17)14-29(19-5-3-2-4-6-19)22(30)16-9-11-26-12-10-16/h2-13,20H,1,14-15H2/b28-21- |
| InChIKey | ZEJWCTVQJGQANX-HFTWOUSFSA-N |
| XLogP | 3.97 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|