C19H20FN3O4S — CID 126541339
methyl 4-[[ethylsulfonyl-(1-methylindazol-4-yl)amino]methyl]-3-fluorobenzoate (PubChem CID 126541339) has the molecular formula C19H20FN3O4S and a molecular weight of 405.45 g/mol. Its IUPAC name is methyl 4-[[ethylsulfonyl-(1-methylindazol-4-yl)amino]methyl]-3-fluorobenzoate.
| Compound Name | methyl 4-[[ethylsulfonyl-(1-methylindazol-4-yl)amino]methyl]-3-fluorobenzoate |
|---|---|
| PubChem CID | 126541339 |
| Molecular Formula | C19H20FN3O4S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | methyl 4-[[ethylsulfonyl-(1-methylindazol-4-yl)amino]methyl]-3-fluorobenzoate |
| SMILES | CCS(=O)(=O)N(Cc1ccc(C(=O)OC)cc1F)c1cccc2c1cnn2C |
| InChI | InChI=1S/C19H20FN3O4S/c1-4-28(25,26)23(18-7-5-6-17-15(18)11-21-22(17)2)12-14-9-8-13(10-16(14)20)19(24)27-3/h5-11H,4,12H2,1-3H3 |
| InChIKey | LQILVNQSSCSUDA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |