C19H19FN3O4S- — CID 126506799
4-[2-[(2-fluoro-4-methoxycarbonylphenyl)methyl-sulfinatoamino]ethyl]-1-methylindazole (PubChem CID 126506799) has the molecular formula C19H19FN3O4S- and a molecular weight of 404.44 g/mol. Its IUPAC name is 4-[2-[(2-fluoro-4-methoxycarbonylphenyl)methyl-sulfinatoamino]ethyl]-1-methylindazole.
| Compound Name | 4-[2-[(2-fluoro-4-methoxycarbonylphenyl)methyl-sulfinatoamino]ethyl]-1-methylindazole |
|---|---|
| PubChem CID | 126506799 |
| Molecular Formula | C19H19FN3O4S- |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 4-[2-[(2-fluoro-4-methoxycarbonylphenyl)methyl-sulfinatoamino]ethyl]-1-methylindazole |
| SMILES | COC(=O)c1ccc(CN(CCc2cccc3c2cnn3C)S(=O)[O-])c(F)c1 |
| InChI | InChI=1S/C19H20FN3O4S/c1-22-18-5-3-4-13(16(18)11-21-22)8-9-23(28(25)26)12-15-7-6-14(10-17(15)20)19(24)27-2/h3-7,10-11H,8-9,12H2,1-2H3,(H,25,26)/p-1 |
| InChIKey | RWSVLEXYHPNXLL-UHFFFAOYSA-M |
| XLogP | 2.34 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|