C19H22N3O4S- — CID 126508135
4-[2-[(5-methoxycarbonyl-2-pyridinyl)methyl-sulfinatoamino]ethyl]-2-methyl-1,3-dihydroisoindole (PubChem CID 126508135) has the molecular formula C19H22N3O4S- and a molecular weight of 388.47 g/mol. Its IUPAC name is 4-[2-[(5-methoxycarbonyl-2-pyridinyl)methyl-sulfinatoamino]ethyl]-2-methyl-1,3-dihydroisoindole.
| Compound Name | 4-[2-[(5-methoxycarbonyl-2-pyridinyl)methyl-sulfinatoamino]ethyl]-2-methyl-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 126508135 |
| Molecular Formula | C19H22N3O4S- |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 4-[2-[(5-methoxycarbonyl-2-pyridinyl)methyl-sulfinatoamino]ethyl]-2-methyl-1,3-dihydroisoindole |
| SMILES | COC(=O)c1ccc(CN(CCc2cccc3c2CN(C)C3)S(=O)[O-])nc1 |
| InChI | InChI=1S/C19H23N3O4S/c1-21-11-16-5-3-4-14(18(16)13-21)8-9-22(27(24)25)12-17-7-6-15(10-20-17)19(23)26-2/h3-7,10H,8-9,11-13H2,1-2H3,(H,24,25)/p-1 |
| InChIKey | YNTPIUPNTFEGET-UHFFFAOYSA-M |
| XLogP | 1.65 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|