C23H29N2O5S- — CID 126506044
4-(hydroxymethyl)-1-[2-[2-[(4-methoxycarbonylphenyl)methyl-sulfinatoamino]ethyl]phenyl]piperidine (PubChem CID 126506044) has the molecular formula C23H29N2O5S- and a molecular weight of 445.56 g/mol. Its IUPAC name is 4-(hydroxymethyl)-1-[2-[2-[(4-methoxycarbonylphenyl)methyl-sulfinatoamino]ethyl]phenyl]piperidine.
| Compound Name | 4-(hydroxymethyl)-1-[2-[2-[(4-methoxycarbonylphenyl)methyl-sulfinatoamino]ethyl]phenyl]piperidine |
|---|---|
| PubChem CID | 126506044 |
| Molecular Formula | C23H29N2O5S- |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 4-(hydroxymethyl)-1-[2-[2-[(4-methoxycarbonylphenyl)methyl-sulfinatoamino]ethyl]phenyl]piperidine |
| SMILES | COC(=O)c1ccc(CN(CCc2ccccc2N2CCC(CO)CC2)S(=O)[O-])cc1 |
| InChI | InChI=1S/C23H30N2O5S/c1-30-23(27)21-8-6-18(7-9-21)16-25(31(28)29)15-12-20-4-2-3-5-22(20)24-13-10-19(17-26)11-14-24/h2-9,19,26H,10-17H2,1H3,(H,28,29)/p-1 |
| InChIKey | GWCNCMIQFYFSSR-UHFFFAOYSA-M |
| XLogP | 2.52 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|