C17H17FNO5S- — CID 126507977
2-fluoro-4-methoxycarbonyl-1-[[(4-methoxyphenyl)methyl-sulfinatoamino]methyl]benzene (PubChem CID 126507977) has the molecular formula C17H17FNO5S- and a molecular weight of 366.39 g/mol. Its IUPAC name is 2-fluoro-4-methoxycarbonyl-1-[[(4-methoxyphenyl)methyl-sulfinatoamino]methyl]benzene.
| Compound Name | 2-fluoro-4-methoxycarbonyl-1-[[(4-methoxyphenyl)methyl-sulfinatoamino]methyl]benzene |
|---|---|
| PubChem CID | 126507977 |
| Molecular Formula | C17H17FNO5S- |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 2-fluoro-4-methoxycarbonyl-1-[[(4-methoxyphenyl)methyl-sulfinatoamino]methyl]benzene |
| SMILES | COC(=O)c1ccc(CN(Cc2ccc(OC)cc2)S(=O)[O-])c(F)c1 |
| InChI | InChI=1S/C17H18FNO5S/c1-23-15-7-3-12(4-8-15)10-19(25(21)22)11-14-6-5-13(9-16(14)18)17(20)24-2/h3-9H,10-11H2,1-2H3,(H,21,22)/p-1 |
| InChIKey | IMDVBAJAEAKHTE-UHFFFAOYSA-M |
| XLogP | 2.42 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|