C22H28N2O4S — CID 175126809
1-[3-[(4-methoxycarbonylphenyl)methyl-sulfinoamino]-1-phenylpropyl]pyrrolidine (PubChem CID 175126809) has the molecular formula C22H28N2O4S and a molecular weight of 416.54 g/mol. Its IUPAC name is 1-[3-[(4-methoxycarbonylphenyl)methyl-sulfinoamino]-1-phenylpropyl]pyrrolidine.
| Compound Name | 1-[3-[(4-methoxycarbonylphenyl)methyl-sulfinoamino]-1-phenylpropyl]pyrrolidine |
|---|---|
| PubChem CID | 175126809 |
| Molecular Formula | C22H28N2O4S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 1-[3-[(4-methoxycarbonylphenyl)methyl-sulfinoamino]-1-phenylpropyl]pyrrolidine |
| SMILES | COC(=O)c1ccc(CN(CCC(c2ccccc2)N2CCCC2)S(=O)O)cc1 |
| InChI | InChI=1S/C22H28N2O4S/c1-28-22(25)20-11-9-18(10-12-20)17-24(29(26)27)16-13-21(23-14-5-6-15-23)19-7-3-2-4-8-19/h2-4,7-12,21H,5-6,13-17H2,1H3,(H,26,27) |
| InChIKey | WLWGTNNIKUYJSB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|