C21H29N3 — CID 110452328
4-[(dimethylamino)methyl]-N-(2-phenyl-2-pyrrolidin-1-ylethyl)aniline (PubChem CID 110452328) has the molecular formula C21H29N3 and a molecular weight of 323.48 g/mol. Its IUPAC name is 4-[(dimethylamino)methyl]-N-(2-phenyl-2-pyrrolidin-1-ylethyl)aniline.
| Compound Name | 4-[(dimethylamino)methyl]-N-(2-phenyl-2-pyrrolidin-1-ylethyl)aniline |
|---|---|
| PubChem CID | 110452328 |
| Molecular Formula | C21H29N3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | 4-[(dimethylamino)methyl]-N-(2-phenyl-2-pyrrolidin-1-ylethyl)aniline |
| SMILES | CN(C)Cc1ccc(NCC(c2ccccc2)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H29N3/c1-23(2)17-18-10-12-20(13-11-18)22-16-21(24-14-6-7-15-24)19-8-4-3-5-9-19/h3-5,8-13,21-22H,6-7,14-17H2,1-2H3 |
| InChIKey | IHQQFMAQWKLFED-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |