C24H36IN5O — CID 111326851
1-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methyl-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111326851) has the molecular formula C24H36IN5O and a molecular weight of 537.49 g/mol. Its IUPAC name is 1-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methyl-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methyl-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111326851 |
| Molecular Formula | C24H36IN5O |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 1-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methyl-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(NCCOC)cc1)NCC(c1ccccc1)N1CCCC1.I |
| InChI | InChI=1S/C24H35N5O.HI/c1-25-24(27-18-20-10-12-22(13-11-20)26-14-17-30-2)28-19-23(29-15-6-7-16-29)21-8-4-3-5-9-21;/h3-5,8-13,23,26H,6-7,14-19H2,1-2H3,(H2,25,27,28);1H |
| InChIKey | WWJDZNSNJBQJHE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 60.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|