C27H40N6 — CID 111326224
2-methyl-1-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine (PubChem CID 111326224) has the molecular formula C27H40N6 and a molecular weight of 448.66 g/mol. Its IUPAC name is 2-methyl-1-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine.
| Compound Name | 2-methyl-1-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111326224 |
| Molecular Formula | C27H40N6 |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.33 |
| IUPAC Name | 2-methyl-1-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine |
| SMILES | C/N=C(/NCc1ccc(CN2CCN(C)CC2)cc1)NCC(c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C27H40N6/c1-28-27(30-21-26(33-14-6-7-15-33)25-8-4-3-5-9-25)29-20-23-10-12-24(13-11-23)22-32-18-16-31(2)17-19-32/h3-5,8-13,26H,6-7,14-22H2,1-2H3,(H2,28,29,30) |
| InChIKey | QCWKDHOHJWQXNV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|