C23H40N6 — CID 111326758
2-methyl-1-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine (PubChem CID 111326758) has the molecular formula C23H40N6 and a molecular weight of 400.62 g/mol. Its IUPAC name is 2-methyl-1-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine.
| Compound Name | 2-methyl-1-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111326758 |
| Molecular Formula | C23H40N6 |
| Molecular Weight | 400.62 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | 2-methyl-1-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine |
| SMILES | C/N=C(/NCC(C)CN1CCN(C)CC1)NCC(c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C23H40N6/c1-20(19-28-15-13-27(3)14-16-28)17-25-23(24-2)26-18-22(29-11-7-8-12-29)21-9-5-4-6-10-21/h4-6,9-10,20,22H,7-8,11-19H2,1-3H3,(H2,24,25,26) |
| InChIKey | HERYYDOPFNJTJO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.62 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|