C11H12FN5O2 — CID 167797945
methyl 3-fluoro-4-[[(1-methyltetrazol-5-yl)amino]methyl]benzoate (PubChem CID 167797945) has the molecular formula C11H12FN5O2 and a molecular weight of 265.25 g/mol. Its IUPAC name is methyl 3-fluoro-4-[[(1-methyltetrazol-5-yl)amino]methyl]benzoate.
| Compound Name | methyl 3-fluoro-4-[[(1-methyltetrazol-5-yl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 167797945 |
| Molecular Formula | C11H12FN5O2 |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | methyl 3-fluoro-4-[[(1-methyltetrazol-5-yl)amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNc2nnnn2C)c(F)c1 |
| InChI | InChI=1S/C11H12FN5O2/c1-17-11(14-15-16-17)13-6-8-4-3-7(5-9(8)12)10(18)19-2/h3-5H,6H2,1-2H3,(H,13,14,16) |
| InChIKey | HLJYXQWAVKUHRW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |